For research use only. Not for therapeutic Use.
TSPO ligand-2（Cat No.:I043340）is a selective small-molecule compound that binds to the translocator protein (TSPO), a protein found in the outer mitochondrial membrane. TSPO is involved in key cellular processes such as mitochondrial function, steroidogenesis, and regulation of inflammation. By modulating TSPO activity, TSPO ligand-2 holds potential in treating neuroinflammatory and neurodegenerative diseases, including Alzheimer’s disease, Parkinson’s disease, and multiple sclerosis. Research on TSPO ligands like TSPO ligand-2 focuses on their ability to reduce neuroinflammation and promote neuroprotection, offering promising therapeutic options for central nervous system disorders.
| CAS Number | 1160640-95-8 |
| Synonyms | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (4-nitrophenyl) carbonate |
| Molecular Formula | C23H29NO8 |
| Purity | ≥95% |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] (4-nitrophenyl) carbonate |
| InChI | InChI=1S/C23H29NO8/c1-14(2)5-10-18-22(3,32-18)20-19(28-4)17(11-12-23(20)13-29-23)31-21(25)30-16-8-6-15(7-9-16)24(26)27/h5-9,17-20H,10-13H2,1-4H3/t17-,18-,19-,20-,22+,23+/m1/s1 |
| InChIKey | APRLZHSZVREOFG-HUCDYXQFSA-N |
| SMILES | CC(=CC[C@@H]1[C@@](O1)(C)[C@H]2[C@@H]([C@@H](CC[C@]23CO3)OC(=O)OC4=CC=C(C=C4)[N+](=O)[O-])OC)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
