For research use only. Not for therapeutic Use.
TT-012 specifically binds to dynamic MITF and destroys the latter’s dimer formation and DNA-binding ability. TT-012 inhibits the transcriptional activity of MITF in B16F10 melanoma cells. TT-012 inhibits the growth of high-MITF melanoma cells, and inhibits the tumor growth and metastasis with tolerable toxicity to liver and immune cells in animal models[1].
| Catalog Number | I040550 |
| CAS Number | 1164471-33-3 |
| Synonyms | (E)-3-(furan-2-yl)-N-[6-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]pyridin-2-yl]prop-2-enamide |
| Molecular Formula | C19H15N3O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C19H15N3O4/c23-18(10-8-14-4-2-12-25-14)21-16-6-1-7-17(20-16)22-19(24)11-9-15-5-3-13-26-15/h1-13H,(H2,20,21,22,23,24)/b10-8+,11-9+ |
| InChIKey | YUFJMFXVUUMVCA-GFULKKFKSA-N |
| SMILES | C1=CC(=NC(=C1)NC(=O)C=CC2=CC=CO2)NC(=O)C=CC3=CC=CO3 |
| Reference | [1]. Liu Z, et al. A unique hyperdynamic dimer interface permits small molecule perturbation of the melanoma oncoprotein MITF for melanoma therapy. Cell Res. 2023 Jan;33(1):55-70. |
