For research use only. Not for therapeutic Use.
TT3(Cat No.:I042908)is a synthetic compound known for its role in modulating immune responses. It has shown potential as an immunomodulatory agent, primarily by influencing the activation and function of T-cells. TT3 works by targeting specific receptors or enzymes involved in immune cell signaling, which can help regulate inflammation and immune response. This makes it a promising candidate for treating autoimmune diseases, inflammatory conditions, and other immune-related disorders. Ongoing research is exploring TT3’s therapeutic potential, aiming to provide a novel approach to managing diseases driven by dysregulated immune responses.
CAS Number | 1821214-50-9 |
Synonyms | 1-N,3-N,5-N-tris[3-(didodecylamino)propyl]benzene-1,3,5-tricarboxamide |
Molecular Formula | C90H174N6O3 |
Purity | ≥95% |
IUPAC Name | 1-N,3-N,5-N-tris[3-(didodecylamino)propyl]benzene-1,3,5-tricarboxamide |
InChI | InChI=1S/C90H174N6O3/c1-7-13-19-25-31-37-43-49-55-61-73-94(74-62-56-50-44-38-32-26-20-14-8-2)79-67-70-91-88(97)85-82-86(89(98)92-71-68-80-95(75-63-57-51-45-39-33-27-21-15-9-3)76-64-58-52-46-40-34-28-22-16-10-4)84-87(83-85)90(99)93-72-69-81-96(77-65-59-53-47-41-35-29-23-17-11-5)78-66-60-54-48-42-36-30-24-18-12-6/h82-84H,7-81H2,1-6H3,(H,91,97)(H,92,98)(H,93,99) |
InChIKey | KIOSQLHXJYTPDN-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCN(CCCCCCCCCCCC)CCCNC(=O)C1=CC(=CC(=C1)C(=O)NCCCN(CCCCCCCCCCCC)CCCCCCCCCCCC)C(=O)NCCCN(CCCCCCCCCCCC)CCCCCCCCCCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |