For research use only. Not for therapeutic Use.
Tubastatin A hydrochloride(Cat No.:I001190)is a selective inhibitor of histone deacetylases (HDACs), particularly HDAC6. It plays a crucial role in regulating gene expression and protein degradation, which can influence various cellular processes, including cell survival and differentiation. Researchers are investigating its potential therapeutic applications in cancer and neurodegenerative diseases, as inhibiting HDAC6 may promote neuroprotection and enhance the degradation of misfolded proteins. The hydrochloride form improves solubility and stability for pharmaceutical use. Tubastatin A’s unique mechanism makes it a promising candidate for targeted therapies in oncology and neurology.
CAS Number | 1310693-92-5 |
Synonyms | N-hydroxy-4-[(2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]benzamide;hydrochloride |
Molecular Formula | C20H21N3O2.HCl |
Purity | ≥95% |
Target | Cell Cycle/DNA Damage |
Solubility | DMSO: ≤ 10.8 mg/mL |
Storage | 3 years -20C powder |
IC50 | 15 nM |
IUPAC Name | N-hydroxy-4-[(2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)methyl]benzamide;hydrochloride |
InChI | InChI=1S/C20H21N3O2.ClH/c1-22-11-10-19-17(13-22)16-4-2-3-5-18(16)23(19)12-14-6-8-15(9-7-14)20(24)21-25;/h2-9,25H,10-13H2,1H3,(H,21,24);1H |
InChIKey | LJTSJTWIMOGKRJ-UHFFFAOYSA-N |
SMILES | CN1CCC2=C(C1)C3=CC=CC=C3N2CC4=CC=C(C=C4)C(=O)NO.Cl |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |