For research use only. Not for therapeutic Use.
Tuberostemonine(Cat No.:R072740), is a chemical compound found in various plant species, including those of the genus Stemona. It is a bioactive alkaloid with diverse pharmacological properties. Tuberostemonine has been studied for its potential antitussive, antifungal, and insecticidal activities. It is also considered a biopesticide due to its efficacy in controlling certain insect pests. Its wide range of biological activities makes it valuable in various research fields, including pharmacology and agriculture.
CAS Number | 6879-01-2 |
Molecular Formula | C22H33NO4 |
Purity | ≥95% |
Target | Parasite |
Storage | 2-8°C(protect from light) |
IUPAC Name | (1R,3S,9R,10R,11S,14S,15S,16R)-10-ethyl-14-methyl-3-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-12-oxa-4-azatetracyclo[7.6.1.04,16.011,15]hexadecan-13-one |
InChI | InChI=1S/C22H33NO4/c1-4-13-14-7-5-6-8-23-16(17-9-11(2)21(24)26-17)10-15(19(14)23)18-12(3)22(25)27-20(13)18/h11-20H,4-10H2,1-3H3/t11-,12-,13+,14+,15+,16-,17-,18+,19+,20-/m0/s1 |
InChIKey | GYOGHROCTSEKDY-JJDZUBOLSA-N |
SMILES | CCC1C2CCCCN3C2C(CC3C4CC(C(=O)O4)C)C5C1OC(=O)C5C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |