For research use only. Not for therapeutic Use.
Tubotaiwine(Cat No.:R048203), is a natural compound found in certain plant species, including Tubotaiwillow (Salix tubuliflora). This chemical is classified as a phytochemical, specifically a phenolic compound, and is known for its potential antioxidant properties. It has been studied for its ability to scavenge free radicals, which can cause cellular damage and contribute to various health issues. While tubotaiwine’s exact biological activities and applications are still under investigation, its presence in plants highlights its role in the plant kingdom’s defense mechanisms and may have implications for future medical and nutrition uses.
CAS Number | 6711-69-9 |
Molecular Formula | C20H24N2O2 |
Purity | ≥95% |
Storage | -20 °C |
IUPAC Name | methyl 18-ethyl-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carboxylate |
InChI | InChI=1S/C20H24N2O2/c1-3-12-13-8-10-22-11-9-20(18(12)22)14-6-4-5-7-15(14)21-17(20)16(13)19(23)24-2/h4-7,12-13,18,21H,3,8-11H2,1-2H3 |
InChIKey | RLAKWLFUMAABBE-UHFFFAOYSA-N |
SMILES | CCC1C2CCN3C1C4(CC3)C5=CC=CC=C5NC4=C2C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |