For research use only. Not for therapeutic Use.
Tubulin inhibitor 1(Cat No.:I019613) is a compound that belongs to the class of tubulin inhibitors. It is designed to specifically target and inhibit the function of tubulin, a protein involved in the formation of microtubules, which are essential for cellular processes such as cell division and intracellular transport. By interfering with tubulin function, this inhibitor disrupts microtubule dynamics and can potentially inhibit the growth and proliferation of cancer cells. However, further research is needed to fully understand its mechanism of action and potential therapeutic applications.
| Catalog Number | I019613 |
| CAS Number | 2237054-53-2 |
| Molecular Formula | C₂₁H₂₄N₂O₄ |
| Purity | ≥95% |
| IUPAC Name | 4-(4-ethoxyphenyl)-1-methyl-3-(3,4,5-trimethoxyphenyl)pyrazole |
| InChI | InChI=1S/C21H24N2O4/c1-6-27-16-9-7-14(8-10-16)17-13-23(2)22-20(17)15-11-18(24-3)21(26-5)19(12-15)25-4/h7-13H,6H2,1-5H3 |
| InChIKey | YWYCRTNRTJCKHS-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=CN(N=C2C3=CC(=C(C(=C3)OC)OC)OC)C |
| Reference | [1]. Lai Q, et al. Design, synthesis and biological evaluation of a novel tubulin inhibitor 7a3. Eur J Med Chem. 2018 Aug 5;156:162-179. |
