For research use only. Not for therapeutic Use.
TUG-1387（Cat No.:M281235）is a novel, selective inhibitor of the protein phosphatase 2A (PP2A), a serine/threonine phosphatase involved in regulating key cellular processes such as cell growth, differentiation, and survival. By inhibiting PP2A, TUG-1387 aims to modulate signaling pathways involved in cancer cell proliferation and apoptosis. It has shown promise in preclinical studies for the treatment of various cancers, including solid tumors and hematological malignancies. TUG-1387’s ability to selectively target PP2A may provide an effective therapeutic strategy, especially for cancers that exhibit dysregulated phosphatase activity. Ongoing research focuses on its clinical development.
| CAS Number | 6319-64-8 |
| Synonyms | 4-methyl-N-(9H-xanthen-9-yl)benzamide |
| Molecular Formula | C21H17NO2 |
| Purity | ≥95% |
| IUPAC Name | 4-methyl-N-(9H-xanthen-9-yl)benzamide |
| InChI | InChI=1S/C21H17NO2/c1-14-10-12-15(13-11-14)21(23)22-20-16-6-2-4-8-18(16)24-19-9-5-3-7-17(19)20/h2-13,20H,1H3,(H,22,23) |
| InChIKey | RWLHMQMVSKQATK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)NC2C3=CC=CC=C3OC4=CC=CC=C24 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
