For research use only. Not for therapeutic Use.
Tutocaine hydrochloride is a local anaesthetic.
| Catalog Number | I037629 |
| CAS Number | 532-62-7 |
| Synonyms | Butamin; |
| Molecular Formula | C14H23ClN2O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4-(dimethylamino)-3-methylbutan-2-yl 4-aminobenzoate hydrochloride |
| InChI | InChI=1S/C14H22N2O2.ClH/c1-10(9-16(3)4)11(2)18-14(17)12-5-7-13(15)8-6-12;/h5-8,10-11H,9,15H2,1-4H3;1H |
| InChIKey | ZGKJESGFAPAQKB-UHFFFAOYSA-N |
| SMILES | CC(C(OC(c1ccc(N)cc1)=O)C)CN(C)C.Cl |
