For research use only. Not for therapeutic Use.
TVD-0003510(Cat No.:I042941)is a novel small molecule compound that functions as an inhibitor targeting specific enzymes involved in cellular processes related to cancer and other diseases. It is designed to modulate key signaling pathways that regulate cell survival, growth, and apoptosis, with a focus on tumor cells. TVD-0003510 is being explored for its potential in treating cancers that rely on dysregulated cellular pathways for progression. Preclinical studies have shown promising results, and it is currently undergoing investigation in clinical trials as part of targeted cancer therapy strategies.
CAS Number | 2355276-51-4 |
Synonyms | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-4-[4-(piperazin-1-ylmethyl)phenyl]-1,2,4-triazole-3-carboxamide |
Molecular Formula | C25H32N6O3 |
Purity | ≥95% |
IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-4-[4-(piperazin-1-ylmethyl)phenyl]-1,2,4-triazole-3-carboxamide |
InChI | InChI=1S/C25H32N6O3/c1-4-27-25(34)24-29-28-23(20-13-19(16(2)3)21(32)14-22(20)33)31(24)18-7-5-17(6-8-18)15-30-11-9-26-10-12-30/h5-8,13-14,16,26,32-33H,4,9-12,15H2,1-3H3,(H,27,34) |
InChIKey | SEJLSUIGJULNEN-UHFFFAOYSA-N |
SMILES | CCNC(=O)C1=NN=C(N1C2=CC=C(C=C2)CN3CCNCC3)C4=CC(=C(C=C4O)O)C(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |