For research use only. Not for therapeutic Use.
TW-37 (Cat.No:I005282) is a synthetic small molecule that exhibits anticancer properties. It functions as a potent inhibitor of multiple anti-apoptotic proteins, including Bcl-2, Bcl-xL, and Mcl-1, promoting apoptosis in cancer cells. TW-37 has shown promise in preclinical studies as a potential therapeutic agent for various types of cancer.
| Catalog Number | I005282 |
| CAS Number | 877877-35-5 |
| Synonyms | N-[4-(2-tert-butylphenyl)sulfonylphenyl]-2,3,4-trihydroxy-5-[(2-propan-2-ylphenyl)methyl]benzamide |
| Molecular Formula | C₃₃H₃₅NO₆S |
| Purity | ≥95% |
| Target | Bcl-2 Family |
| Solubility | DMSO: ≥ 42 mg/mL |
| Storage | -20 ℃ |
| IC50 | 0.29 μM (Ki for Bcl-2) |
| InChI | InChI=1S/C33H35NO6S/c1-20(2)25-11-7-6-10-21(25)18-22-19-26(30(36)31(37)29(22)35)32(38)34-23-14-16-24(17-15-23)41(39,40)28-13-9-8-12-27(28)33(3,4)5/h6-17,19-20,35-37H,18H2,1-5H3,(H,34,38) |
| InChIKey | PQAPVTKIEGUPRN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC=C1CC2=C(C(=C(C(=C2)C(=O)NC3=CC=C(C=C3)S(=O)(=O)C4=CC=CC=C4C(C)(C)C)O)O)O |
