For research use only. Not for therapeutic Use.
TYA-018(Cat No.:I041277)is an investigational small molecule that acts as a selective inhibitor targeting specific signaling pathways involved in cancer cell growth and survival. It has been studied primarily for its potential therapeutic applications in the treatment of various cancers. TYA-018 works by disrupting key molecular interactions within cancer cells, leading to reduced proliferation and promoting apoptosis. Early preclinical studies have shown promising results in inhibiting tumor growth. Research is ongoing to further evaluate its efficacy, safety, and potential as a targeted treatment for multiple types of malignancies and related diseases.
CAS Number | 2653254-31-8 |
Synonyms | N-(3-chlorophenyl)-N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-thiazol-2-yl]methyl]ethanesulfonamide |
Molecular Formula | C15H13ClF2N4O3S2 |
Purity | ≥95% |
IUPAC Name | N-(3-chlorophenyl)-N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-thiazol-2-yl]methyl]ethanesulfonamide |
InChI | InChI=1S/C15H13ClF2N4O3S2/c1-2-27(23,24)22(10-5-3-4-9(16)6-10)8-12-19-7-11(26-12)14-20-21-15(25-14)13(17)18/h3-7,13H,2,8H2,1H3 |
InChIKey | DAMJZODYLBMFHQ-UHFFFAOYSA-N |
SMILES | CCS(=O)(=O)N(CC1=NC=C(S1)C2=NN=C(O2)C(F)F)C3=CC(=CC=C3)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |