For research use only. Not for therapeutic Use.
Tyk2-IN-8(Cat No.:S000432) is a potent and selective inhibitor of Tyk2 (Tyrosine kinase 2), a Janus kinase involved in the signaling pathways of several cytokines that regulate immune responses, inflammation, and hematopoiesis. It is particularly studied for its potential therapeutic effects in treating autoimmune diseases and certain cancers. By inhibiting Tyk2, Tyk2-IN-8 can interfere with the JAK-STAT signaling pathway, which plays a crucial role in the pathogenesis of these conditions. This makes it a promising candidate for the development of new treatments for disorders like psoriasis, rheumatoid arthritis, and myeloproliferative neoplasms.
CAS Number | 2704587-24-4 |
Molecular Formula | C20H19D3N8O3 |
Purity | ≥95% |
IUPAC Name | 6-(cyclopropanecarbonylamino)-N-methyl-4-[3-(1-methyl-1,2,4-triazol-3-yl)-2-(trideuteriomethoxy)anilino]pyridazine-3-carboxamide |
InChI | InChI=1S/C20H22N8O3/c1-21-20(30)16-14(9-15(25-26-16)24-19(29)11-7-8-11)23-13-6-4-5-12(17(13)31-3)18-22-10-28(2)27-18/h4-6,9-11H,7-8H2,1-3H3,(H,21,30)(H2,23,24,25,29)/i3D3 |
InChIKey | BZZKEPGENYLQSC-HPRDVNIFSA-N |
SMILES | CNC(=O)C1=NN=C(C=C1NC2=CC=CC(=C2OC)C3=NN(C=N3)C)NC(=O)C4CC4 |