For research use only. Not for therapeutic Use.
Tyrosinamide(CAT: I037664) is a tyrosine derivative and chiral ligand extensively utilized in biochemical research and molecular engineering. It has been particularly instrumental in the in vitro selection of DNA aptamers, aiding the development of aptamer-based biosensors. These biosensors are valuable for detecting specific targets due to their high affinity and selectivity. The unique properties of Tyrosinamide, including its structural mimicry of tyrosine and ability to participate in selective binding interactions, make it a crucial component in studies focused on molecular recognition, ligand-receptor interactions, and biosensor optimization. With its chiral nature, it supports advanced applications in both diagnostic and therapeutic research.
| Catalog Number | I037664 |
| CAS Number | 4985-46-0 |
| Synonyms | L-Tyrosine amide; L-Tyrosineamide; |
| Molecular Formula | C9H12N2O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-2-amino-3-(4-hydroxyphenyl)propanamide |
| InChI | InChI=1S/C9H12N2O2/c10-8(9(11)13)5-6-1-3-7(12)4-2-6/h1-4,8,12H,5,10H2,(H2,11,13)/t8-/m0/s1 |
| InChIKey | PQFMNVGMJJMLAE-QMMMGPOBSA-N |
| SMILES | N[C@H](C(N)=O)Cc1ccc(O)cc1 |
