For research use only. Not for therapeutic Use.
Tyrosinase-IN-12(CAT: I040797) is a potent small-molecule tyrosinase inhibitor that targets and suppresses the activity of tyrosinase, a key enzyme in the melanin biosynthesis pathway. By inhibiting tyrosinase, this compound effectively reduces melanin production, making it valuable in research related to skin pigmentation, hyperpigmentation disorders, and cosmetic whitening agents. Tyrosinase-IN-12 is also used in studying oxidative stress and melanogenesis regulation. Its specificity and efficacy make it a useful tool for both pharmaceutical and cosmetic applications, particularly in developing treatments for conditions such as melasma, age spots, and other pigmentary abnormalities.
| CAS Number | 1860779-42-5 |
| Synonyms | N-[(E)-(4-chlorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| Molecular Formula | C16H12ClN3S |
| Purity | ≥95% |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| InChI | InChI=1S/C16H12ClN3S/c17-14-8-6-12(7-9-14)10-18-20-16-19-15(11-21-16)13-4-2-1-3-5-13/h1-11H,(H,19,20)/b18-10+ |
| InChIKey | YQKYELGBAMTOTP-VCHYOVAHSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)NN=CC3=CC=C(C=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
