For research use only. Not for therapeutic Use.
Tyrosylvalinamide (Cat No.: I037673) is a dipeptide composed of tyrosine and valine, known for its potential biological activity and relevance in peptide research. It is studied for its role in modulating cellular processes, including enzyme inhibition and signal transduction. As a simple peptide derivative, Tyrosylvalinamide serves as a model compound in biochemical and pharmacological studies, aiding in the understanding of peptide transport, metabolism, and structure-activity relationships. Its stability and defined structure make it useful in exploring peptide-based drug design and therapeutic development.
| CAS Number | 87237-39-6 |
| Synonyms | Tyr-val-NH2; |
| Molecular Formula | C14H21N3O3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-2-((S)-2-amino-3-(4-hydroxyphenyl)propanamido)-3-methylbutanamide |
| InChI | InChI=1S/C14H21N3O3/c1-8(2)12(13(16)19)17-14(20)11(15)7-9-3-5-10(18)6-4-9/h3-6,8,11-12,18H,7,15H2,1-2H3,(H2,16,19)(H,17,20)/t11-,12-/m0/s1 |
| InChIKey | KETVITBYSZOWFK-RYUDHWBXSA-N |
| SMILES | CC([C@@H](C(N)=O)NC([C@H](Cc1ccc(O)cc1)N)=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
