For research use only. Not for therapeutic Use.
(+)-Tyrphostin B44（Cat No.:I010243）is a potent, selective inhibitor of receptor tyrosine kinases (RTKs), particularly targeting the epidermal growth factor receptor (EGFR). It works by blocking the activation of EGFR and other related kinases, which are involved in cellular processes such as growth, survival, and differentiation. This inhibition can reduce cancer cell proliferation and metastasis. (+)-Tyrphostin B44 has demonstrated promise in preclinical studies as an anti-cancer agent, particularly for tumors with dysregulated EGFR signaling, including non-small cell lung cancer and breast cancer, making it a potential therapeutic candidate in oncology.
| CAS Number | 133550-37-5 |
| Synonyms | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
| Molecular Formula | C18H16N2O3 |
| Purity | ≥95% |
| IUPAC Name | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
| InChI | InChI=1S/C18H16N2O3/c1-12(14-5-3-2-4-6-14)20-18(23)15(11-19)9-13-7-8-16(21)17(22)10-13/h2-10,12,21-22H,1H3,(H,20,23)/b15-9+/t12-/m0/s1 |
| InChIKey | UMGQVUWXNOJOSJ-DGGAMASNSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC(=O)/C(=C/C2=CC(=C(C=C2)O)O)/C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
