For research use only. Not for therapeutic Use.
TYRPHOSTIN B46 (Cat.No:M114677) is a compound belonging to the tyrphostin family, known for its potential as a tyrosine kinase inhibitor. It has been studied for its inhibitory effects on growth factor receptors and signal transduction pathways. TYRPHOSTIN B46 holds promise for research in cancer therapy and other disease-related signaling pathways.
| Catalog Number | M114677 |
| CAS Number | 133550-34-2 |
| Synonyms | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(3-phenylpropyl)acrylamide |
| Molecular Formula | C19H18N2O3 |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Desiccate at +4℃ |
| IUPAC Name | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(3-phenylpropyl)prop-2-enamide |
| InChI | 1S/C19H18N2O3/c20-13-16(11-15-8-9-17(22)18(23)12-15)19(24)21-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11-12,22-23H,4,7,10H2,(H,21,24)/b16-11+ |
| InChIKey | GSQOBTOAOGXIFL-LFIBNONCSA-N |
| SMILES | C1=CC=C(C=C1)CCCNC(=O)/C(=C/C2=CC(=C(C=C2)O)O)/C#N |
