For research use only. Not for therapeutic Use.
U 89674（Cat No.:I037740）is a chemical compound under investigation for its potential pharmacological effects, particularly in the field of neuroscience. It is known as a selective antagonist of the dopamine D2 receptor, which plays a crucial role in regulating mood, motivation, and motor control. By modulating dopamine receptor activity, U 89674 may have applications in treating disorders related to dopaminergic dysfunction, such as schizophrenia or Parkinson’s disease. Although still in the research phase, U 89674 is being studied for its potential to improve the efficacy of treatments targeting these neurological conditions.
| CAS Number | 144674-89-5 |
| Synonyms | U-89674; |
| Molecular Formula | C24H31N7O |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N,N-dimethyl-N'-[2-[4-[3-(propan-2-ylamino)pyridin-2-yl]piperazine-1-carbonyl]-1H-indol-5-yl]methanimidamide |
| InChI | InChI=1S/C24H31N7O/c1-17(2)27-21-6-5-9-25-23(21)30-10-12-31(13-11-30)24(32)22-15-18-14-19(26-16-29(3)4)7-8-20(18)28-22/h5-9,14-17,27-28H,10-13H2,1-4H3 |
| InChIKey | MQLULHDHQQQZQU-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(N=CC=C1)N2CCN(CC2)C(=O)C3=CC4=C(N3)C=CC(=C4)N=CN(C)C |
