For research use only. Not for therapeutic Use.
U 89674 is a non-nucleoside reverse transcriptase inhibitor used for the prevention of the spread of HIV-1 infection.
| Catalog Number | I037740 |
| CAS Number | 144674-89-5 |
| Synonyms | U-89674; |
| Molecular Formula | C24H31N7O |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (E)-N'-(2-(4-(3-(isopropylamino)pyridin-2-yl)piperazine-1-carbonyl)-1H-indol-5-yl)-N,N-dimethylformimidamide |
| InChI | InChI=1S/C24H31N7O/c1-17(2)27-21-6-5-9-25-23(21)30-10-12-31(13-11-30)24(32)22-15-18-14-19(26-16-29(3)4)7-8-20(18)28-22/h5-9,14-17,27-28H,10-13H2,1-4H3/b26-16+ |
| InChIKey | MQLULHDHQQQZQU-WGOQTCKBSA-N |
| SMILES | CC(C)NC1=C(N2CCN(C(C3=CC4=C(C=CC(/N=C/N(C)C)=C4)N3)=O)CC2)N=CC=C1 |
| Reference | 1: Vasudevachari MB, Battista C, Lane HC, Psallidopoulos MC, Zhao B, Cook J, Palmer JR, Romero DL, Tarpley WG, Salzman NP. Prevention of the spread of HIV-1 infection with nonnucleoside reverse transcriptase inhibitors. Virology. 1992 Sep;190(1):269-77. doi: 10.1016/0042-6822(92)91213-e. PMID: 1382341. |
