For research use only. Not for therapeutic Use.
UBCS039（Cat No.:I019198）is a selective inhibitor of the ubiquitin-conjugating enzyme Ubc13, which plays a key role in the ubiquitin-proteasome pathway involved in protein degradation and DNA damage response. By inhibiting Ubc13, UBCS039 interferes with the formation of K63-linked polyubiquitin chains, affecting various cellular processes like DNA repair, immune signaling, and inflammation. This makes UBCS039 a valuable tool in cancer research and studies on immune regulation. Its specificity and potency allow researchers to explore Ubc13-related pathways and their potential as therapeutic targets in oncology and immunology.
| Catalog Number | I019198 |
| CAS Number | 358721-70-7 |
| Molecular Formula | C₁₆H₁₃N₃ |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 4-pyridin-3-yl-4,5-dihydropyrrolo[1,2-a]quinoxaline |
| InChI | InChI=1S/C16H13N3/c1-2-7-14-13(6-1)18-16(12-5-3-9-17-11-12)15-8-4-10-19(14)15/h1-11,16,18H |
| InChIKey | BSOBGTYXYGHUTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(C3=CC=CN32)C4=CN=CC=C4 |
| Reference | [1]. Weijie You, et al. Structural Basis of Sirtuin 6 Activation by Synthetic Small Molecules. Angew. Chem. Int. Ed. 2017, 56, 1007-1011.<br>[2]. Sara Iachettini, et al. Pharmacological activation of SIRT6 triggers lethal autophagy in human cancer cells. Cell Death and Disease (2018) 9:996. |
