For research use only. Not for therapeutic Use.
UCPH-102（Cat No.:I037794）is a selective and potent small-molecule inhibitor targeting the enzyme monoacylglycerol lipase (MAGL), which plays a key role in the breakdown of endocannabinoids. By inhibiting MAGL, UCPH-102 increases the levels of endocannabinoids, which are involved in regulating pain, inflammation, and neuroprotection. This compound has shown promise in preclinical studies for its potential in treating pain, anxiety, and neurodegenerative disorders, such as Alzheimer’s disease. Its ability to modulate the endocannabinoid system positions UCPH-102 as a potential therapeutic agent for a range of neurological and inflammatory conditions.
| CAS Number | 1229591-56-3 |
| Synonyms | 2-amino-4-methyl-7-naphthalen-1-yl-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
| Molecular Formula | C21H18N2O2 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-4-methyl-7-naphthalen-1-yl-5-oxo-4,6,7,8-tetrahydrochromene-3-carbonitrile |
| InChI | InChI=1S/C21H18N2O2/c1-12-17(11-22)21(23)25-19-10-14(9-18(24)20(12)19)16-8-4-6-13-5-2-3-7-15(13)16/h2-8,12,14H,9-10,23H2,1H3 |
| InChIKey | XZQMHUGTNOOYFX-UHFFFAOYSA-N |
| SMILES | CC1C(=C(OC2=C1C(=O)CC(C2)C3=CC=CC4=CC=CC=C43)N)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
