For research use only. Not for therapeutic Use.
Uridine-5′-diphosphate disodium salt(Cat No.:I010703) is a biochemical reagent with versatile applications. It acts as an agonist for the P2Y6 receptor, a G protein-coupled receptor involved in various physiological processes. Activation of the P2Y6 receptor by uridine-5′-diphosphate can modulate immune responses and inflammation. Additionally, it functions as an inhibitor of the GPR105 receptor, which plays a role in the regulation of metabolic pathways.
CAS Number | 27821-45-0 |
Synonyms | Uridine-5/’-diphosphate disodium salt |
Molecular Formula | C9H12N2O12P2 • 2Na |
Purity | ≥95% |
Target | Cell Cycle/DNA Damage |
Solubility | Soluble to 100 mM in water |
Storage | -20°C |
IUPAC Name | disodium;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate |
InChI | InChI=1S/C9H14N2O12P2.2Na/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18;;/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,10,12,15)(H2,16,17,18);;/q;2*+1/p-2/t4-,6-,7-,8-;;/m1../s1 |
InChIKey | ZQKVPFKBNNAXCE-WFIJOQBCSA-L |
SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)[O-])O)O.[Na+].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |