For research use only. Not for therapeutic Use.
UDP-L-arabinose (Cat.No:M084504) is a nucleotide sugar that serves as a crucial precursor in the biosynthesis of arabinose-containing polysaccharides. It plays a vital role in cell wall formation in plants and bacteria. This molecule is pivotal in understanding and manipulating cellular processes involving arabinose-based carbohydrates.
CAS Number | 15839-78-8 |
Synonyms | UDP-L-arabinose |
Molecular Formula | C14H22N2O16P2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl] hydrogen phosphate |
InChI | InChI=1S/C14H22N2O16P2/c17-5-3-28-13(11(22)8(5)19)31-34(26,27)32-33(24,25)29-4-6-9(20)10(21)12(30-6)16-2-1-7(18)15-14(16)23/h1-2,5-6,8-13,17,19-22H,3-4H2,(H,24,25)(H,26,27)(H,15,18,23)/t5-,6+,8-,9+,10+,11+,12+,13+/m0/s1 |
InChIKey | DQQDLYVHOTZLOR-IAZOVDBXSA-N |
SMILES | C1C(C(C(C(O1)OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)O)O)O |