For research use only. Not for therapeutic Use.
UK-371804 HCl(Cat No.:L048699)is a selective antagonist of the neurokinin-3 receptor (NK3R), a receptor implicated in the modulation of reproductive hormones and certain neuropsychiatric conditions. By blocking NK3R, UK-371804 HCl helps regulate the release of gonadotropins, making it a potential candidate for treating conditions like polycystic ovary syndrome (PCOS) and menopausal symptoms. Additionally, its effects on neuropeptide signaling have drawn interest for investigating mood and behavioral disorders. This compound is widely used in research to explore the NK3R pathway’s role in hormone regulation and central nervous system functions.
CAS Number | 256476-36-5 |
Molecular Formula | C14H17Cl2N5O4S |
Purity | ≥95% |
IUPAC Name | 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid;hydrochloride |
InChI | InChI=1S/C14H16ClN5O4S.ClH/c1-14(2,12(21)22)20-25(23,24)7-3-4-8-9(5-7)11(19-13(16)17)18-6-10(8)15;/h3-6,20H,1-2H3,(H,21,22)(H4,16,17,18,19);1H |
InChIKey | IUBFETAFRGVODB-UHFFFAOYSA-N |
SMILES | CC(C)(C(=O)O)NS(=O)(=O)C1=CC2=C(C=C1)C(=CN=C2N=C(N)N)Cl.Cl |