For research use only. Not for therapeutic Use.
Ulodesine (also known as BCX4208) is a potent and selective inhibitor of purine nucleoside phosphorylase (PNP), an enzyme involved in the purine salvage pathway. By inhibiting PNP, ulodesine disrupts the production of uric acid and reduces the proliferation of T-cells, making it a potential therapeutic agent for conditions like gout and autoimmune diseases. It has been studied for its ability to lower uric acid levels in patients with hyperuricemia and for its immunosuppressive effects, offering promise in treating various inflammatory and autoimmune disorders.
| Catalog Number | I009948 |
| CAS Number | 548486-59-5 |
| Synonyms | 7-[[(3R,4R)-3-hydroxy-4-(hydroxymethyl)pyrrolidin-1-yl]methyl]-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| Molecular Formula | C12H16N4O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C12H16N4O3/c17-5-8-3-16(4-9(8)18)2-7-1-13-11-10(7)14-6-15-12(11)19/h1,6,8-9,13,17-18H,2-5H2,(H,14,15,19)/t8-,9+/m1/s1 |
| InChIKey | AFNHHLILYQEHKK-BDAKNGLRSA-N |
| SMILES | C1C(C(CN1CC2=CNC3=C2N=CNC3=O)O)CO |
