For research use only. Not for therapeutic Use.
Umbelliprenin(CAT: I040702) is a naturally occurring prenylated coumarin compound found in various plants of the Ferula genus. It exhibits a wide range of biological activities, including anti-inflammatory, antioxidant, anticancer, and antimicrobial effects. Umbelliprenin has been shown to induce apoptosis and inhibit proliferation in several cancer cell lines, making it a promising candidate for cancer research. Additionally, it modulates immune responses and cellular signaling pathways such as NF-κB and MAPK. Due to its multifunctional pharmacological profile, Umbelliprenin is widely studied for potential applications in oncology, inflammation, and infectious disease research. Suitable for in vitro and in vivo experimental use.
| CAS Number | 23838-17-7 |
| Synonyms | 7-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one |
| Molecular Formula | C24H30O3 |
| Purity | ≥95% |
| IUPAC Name | 7-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one |
| InChI | InChI=1S/C24H30O3/c1-18(2)7-5-8-19(3)9-6-10-20(4)15-16-26-22-13-11-21-12-14-24(25)27-23(21)17-22/h7,9,11-15,17H,5-6,8,10,16H2,1-4H3/b19-9+,20-15+ |
| InChIKey | GNMUGVNEWCZUAA-WOWYBKFKSA-N |
| SMILES | CC(=CCCC(=CCCC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
