For research use only. Not for therapeutic Use.
UMK57(CAT: I037831) is a small-molecule compound that enhances chromosome segregation fidelity by promoting correction of kinetochore-microtubule (k-MT) attachment errors during mitosis. It achieves this by potentiating the activity of mitotic centromere-associated kinesin (MCAK), leading to selective destabilization of improper k-MT attachments. UMK57 is particularly effective in chromosomally unstable (CIN) cancer cells, reducing chromosome missegregation and supporting genomic stability. Widely used in mitosis and cell division research, UMK57 provides valuable insights into mechanisms of spindle checkpoint regulation and therapeutic strategies targeting chromosomal instability. This compound is ideal for studying mitotic regulation, aneuploidy, and potential cancer treatments involving microtubule dynamics.
| CAS Number | 342595-74-8 |
| Synonyms | 5-(4-methylphenyl)-4-pyrrolidin-1-ylthieno[2,3-d]pyrimidine |
| Molecular Formula | C17H17N3S |
| Purity | ≥95% |
| IUPAC Name | 5-(4-methylphenyl)-4-pyrrolidin-1-ylthieno[2,3-d]pyrimidine |
| InChI | InChI=1S/C17H17N3S/c1-12-4-6-13(7-5-12)14-10-21-17-15(14)16(18-11-19-17)20-8-2-3-9-20/h4-7,10-11H,2-3,8-9H2,1H3 |
| InChIKey | VOAWQTDHSSKEKA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC3=NC=NC(=C23)N4CCCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
