For research use only. Not for therapeutic Use.
UNC2025(CAT: I001650) is a potent and orally bioavailable dual inhibitor targeting Mer tyrosine kinase (MerTK) and Fms-like tyrosine kinase 3 (Flt3) with remarkable selectivity, exhibiting IC₅₀ values of 0.8 nM for MerTK and 0.74 nM for Flt3. MerTK is involved in immune regulation and cancer progression, while Flt3 plays a critical role in hematopoietic cell growth and is frequently mutated in acute myeloid leukemia (AML). UNC2025 is highly valuable in oncology research, particularly for investigating targeted therapies for AML and solid tumors, as it disrupts tumor cell survival, proliferation, and immune evasion mechanisms.
| Catalog Number | I001650 |
| CAS Number | 1429881-91-3 |
| Synonyms | (1r,4r)-4-(2-(butylamino)-5-(4-((4-methylpiperazin-1-yl)methyl)phenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexanol |
| Molecular Formula | C₂₈H₄₀N₆O |
| Purity | ≥95% |
| Target | FLT3 |
| Solubility | DMSO: ≥ 5 mg/mL, H2O: ＜ 4.9 mg/mL |
| Storage | Desiccate at -20C |
| IC50 | 0.8/0.74 nM(MER/FLT3) |
| IUPAC Name | 4-[2-(butylamino)-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| InChI | InChI=1S/C28H40N6O/c1-3-4-13-29-28-30-18-25-26(20-34(27(25)31-28)23-9-11-24(35)12-10-23)22-7-5-21(6-8-22)19-33-16-14-32(2)15-17-33/h5-8,18,20,23-24,35H,3-4,9-17,19H2,1-2H3,(H,29,30,31) |
| InChIKey | MJSHVHLADKXCML-UHFFFAOYSA-N |
| SMILES | CCCCNC1=NC=C2C(=CN(C2=N1)C3CCC(CC3)O)C4=CC=C(C=C4)CN5CCN(CC5)C |
