For research use only. Not for therapeutic Use.
UNC 3230 (CAT: I011154) is a potent and selective inhibitor of phosphatidylinositol-4-phosphate 5-kinase type 1C (PIP5K1C), demonstrating an IC50 value of 41 nM. Notably, UNC 3230 exhibits a remarkable selectivity for PIP5K1C, displaying minimal cross-reactivity with PIP5K1A, members of the PI 3-kinase family, and a diverse panel of other kinases. This specificity highlights its potential as a valuable tool compound for investigating the role of PIP5K1C in various cellular processes.
| Catalog Number | I011154 |
| CAS Number | 1031602-63-7 |
| Synonyms | 5-[(Cyclohexylcarbonyl)amino]-2-(phenylamino)-thiazolecarboxamide |
| Molecular Formula | C17H20N4O2S |
| Purity | ≥95% |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | Store at +4C |
| IUPAC Name | 2-anilino-5-(cyclohexanecarbonylamino)-1,3-thiazole-4-carboxamide |
| InChI | InChI=1S/C17H20N4O2S/c18-14(22)13-16(21-15(23)11-7-3-1-4-8-11)24-17(20-13)19-12-9-5-2-6-10-12/h2,5-6,9-11H,1,3-4,7-8H2,(H2,18,22)(H,19,20)(H,21,23) |
| InChIKey | RZCNASHHHSKTGP-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)NC2=C(N=C(S2)NC3=CC=CC=C3)C(=O)N |
