For research use only. Not for therapeutic Use.
UNC-669 (Cat No.: I009954) is a selective small-molecule inhibitor designed for epigenetic and cancer research. It targets lysine methyltransferases, disrupting key protein-protein interactions involved in chromatin regulation and gene expression. By modulating epigenetic pathways, UNC-669 is valuable for studying transcriptional control, cancer progression, and potential therapeutic strategies. Researchers use it to explore treatments for malignancies, including leukemia and solid tumors. Its high specificity and bioavailability ensure reliable experimental outcomes, making it a crucial tool in drug discovery and biomedical research.
| CAS Number | 314241-44-5 |
| Synonyms | UNC669; UNC 669; UNC-669.;(5-bromopyridin-3-yl)(4-(pyrrolidin-1-yl)piperidin-1-yl)methanone |
| Molecular Formula | C15H20BrN3O |
| Purity | ≥95% |
| Target | L3MBTL1 Domain Inhibitor |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IC50 | 5 μM |
| SMILES | O=C(C1=CC(Br)=CN=C1)N2CCC(N3CCCC3)CC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
