For research use only. Not for therapeutic Use.
UNC0642 (CAT: I001817) is a potent and selective inhibitor of the histone methyltransferase G9a/GLP. G9a and GLP are enzymes responsible for adding methyl groups to histone proteins, leading to gene silencing and chromatin remodeling. By inhibiting G9a/GLP, UNC0642 disrupts the methylation process and alters gene expression patterns. This can have therapeutic implications in various diseases, including cancer and neurological disorders. UNC0642 has been used in preclinical studies to investigate the role of G9a/GLP in disease progression and to explore its potential as a therapeutic target.
| Catalog Number | I001817 |
| CAS Number | 1481677-78-4 |
| Synonyms | 2-(4,4-difluoropiperidin-1-yl)-N-(1-isopropylpiperidin-4-yl)-6-methoxy-7-(3-(pyrrolidin-1-yl)propoxy)quinazolin-4-amine |
| Molecular Formula | C29H44F2N6O2 |
| Purity | ≥95% |
| Target | Histone Methyltransferase |
| Solubility | 10 mM in DMSO |
| Storage | Store at +4C |
| IC50 | 45 nM (Ki, H3 receptor), 900 nM (Ki, sigma-2 receptor) |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
| InChI | InChI=1S/C29H44F2N6O2/c1-21(2)36-14-7-22(8-15-36)32-27-23-19-25(38-3)26(39-18-6-13-35-11-4-5-12-35)20-24(23)33-28(34-27)37-16-9-29(30,31)10-17-37/h19-22H,4-18H2,1-3H3,(H,32,33,34) |
| InChIKey | RNAMYOYQYRYFQY-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCC(CC1)NC2=NC(=NC3=CC(=C(C=C32)OC)OCCCN4CCCC4)N5CCC(CC5)(F)F |
| Reference | <p style=”/line-height:25px/”> |
