For research use only. Not for therapeutic Use.
UNC10201652（Cat No.:I042911）is a selective small molecule inhibitor designed to target specific enzymes involved in cellular processes related to cancer and other diseases. It functions by modulating key signaling pathways that regulate cell growth, survival, and differentiation. Through its inhibition, UNC10201652 disrupts aberrant cellular functions associated with disease progression, particularly in oncology. This compound is being investigated for its potential to enhance the effectiveness of cancer therapies by targeting unique molecular pathways. Researchers are exploring its application in combination therapies to improve treatment outcomes for patients with various malignancies.
| CAS Number | 372495-52-8 |
| Synonyms | 4-(13-piperazin-1-yl-11-thia-9,14,15,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-8-yl)morpholine |
| Molecular Formula | C20H25N7OS |
| Purity | ≥95% |
| IUPAC Name | 4-(13-piperazin-1-yl-11-thia-9,14,15,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-8-yl)morpholine |
| InChI | InChI=1S/C20H25N7OS/c1-2-4-14-13(3-1)15-16-17(19(24-25-23-16)26-7-5-21-6-8-26)29-20(15)22-18(14)27-9-11-28-12-10-27/h21H,1-12H2 |
| InChIKey | ZPVQONCMKZBGTB-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N=C2N4CCOCC4)SC5=C3N=NN=C5N6CCNCC6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
