For research use only. Not for therapeutic Use.
UNC2250(CAT: I001837) is a potent inhibitor that targets the endogenous phosphorylation of Mer, a receptor tyrosine kinase involved in various cellular processes. With an impressive IC50 value of 9.8 nM, UNC2250 effectively hinders the phosphorylation of Mer, thereby interfering with its signaling pathways. Additionally, this compound exhibits the ability to block ligand-induced activation of a chimeric EGFR-Mer protein, indicating its potential as a modulator of receptor-mediated cellular responses.
| Catalog Number | I001837 |
| CAS Number | 1493694-70-4 |
| Synonyms | trans-4-[[2-(butylamino)-5-[5-(4-morpholinylmethyl)-2-pyridinyl]-4-pyrimidinyl]amino]-cyclohexanol |
| Molecular Formula | C24H36N6O2 |
| Purity | ≥95% |
| Target | TAM Receptor |
| Solubility | DMSO: ≥ 46 mg/mL |
| Storage | -20°C |
| IC50 | 9.8 nM [1] |
| IUPAC Name | 4-[[2-(butylamino)-5-[5-(morpholin-4-ylmethyl)pyridin-2-yl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| InChI | InChI=1S/C24H36N6O2/c1-2-3-10-25-24-27-16-21(23(29-24)28-19-5-7-20(31)8-6-19)22-9-4-18(15-26-22)17-30-11-13-32-14-12-30/h4,9,15-16,19-20,31H,2-3,5-8,10-14,17H2,1H3,(H2,25,27,28,29) |
| InChIKey | HSYSSKFCQHXOBP-UHFFFAOYSA-N |
| SMILES | CCCCNC1=NC=C(C(=N1)NC2CCC(CC2)O)C3=NC=C(C=C3)CN4CCOCC4 |
| Reference | <p style=/line-height:25px/> |
