For research use only. Not for therapeutic Use.
UNC6934, a chemical probe targeting the PWWP domain, alters NSD2 nucleolar localization.
| Catalog Number | I045182 |
| CAS Number | 2561494-77-5 |
| Synonyms | N-cyclopropyl-3-oxo-N-[[4-(pyrimidin-4-ylcarbamoyl)phenyl]methyl]-4H-1,4-benzoxazine-7-carboxamide |
| Molecular Formula | C24H21N5O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C24H21N5O4/c30-22-13-33-20-11-17(5-8-19(20)27-22)24(32)29(18-6-7-18)12-15-1-3-16(4-2-15)23(31)28-21-9-10-25-14-26-21/h1-5,8-11,14,18H,6-7,12-13H2,(H,27,30)(H,25,26,28,31) |
| InChIKey | KOZGEDUWAQFVAV-UHFFFAOYSA-N |
| SMILES | C1CC1N(CC2=CC=C(C=C2)C(=O)NC3=NC=NC=C3)C(=O)C4=CC5=C(C=C4)NC(=O)CO5 |
| Reference | [1]. Dilworth D, et al. A chemical probe targeting the PWWP domain alters NSD2 nucleolar localization. Nat Chem Biol. 2022 Jan;18(1):56-63. |
