For research use only. Not for therapeutic Use.
UNC9995 is a selective inhibitor of the methyltransferase enzyme G9a, which plays a critical role in the epigenetic regulation of gene expression through the methylation of histone H3 lysine 9 (H3K9). By inhibiting G9a, UNC9995 reduces H3K9 methylation, leading to alterations in chromatin structure and gene expression. This compound is used in research to study the role of G9a in cancer and other diseases where epigenetic dysregulation is involved, offering potential insights into novel therapeutic strategies targeting epigenetic mechanisms.
| Catalog Number | I009956 |
| CAS Number | 1354030-52-6 |
| Synonyms | 5-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-1,3-benzothiazole |
| Molecular Formula | C20H21Cl2N3OS |
| Purity | ≥95% |
| InChI | InChI=1S/C20H21Cl2N3OS/c21-16-3-1-4-18(20(16)22)25-10-8-24(9-11-25)7-2-12-26-15-5-6-19-17(13-15)23-14-27-19/h1,3-6,13-14H,2,7-12H2 |
| InChIKey | VBHBKXBUHHJVBZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCOC2=CC3=C(C=C2)SC=N3)C4=C(C(=CC=C4)Cl)Cl |
