For research use only. Not for therapeutic Use.
Ungeremine（Cat No.:R072602）, is a naturally occurring alkaloid compound derived from the plant Urginea maritima, commonly known as the sea squill or maritime squill. This compound has been investigated for its biological activities and is known for its potential cardiac glycoside properties. Cardiac glycosides like ungeremine can influence heart muscle contractions and have been studied for their potential therapeutic applications, particularly in treating heart conditions.
| Catalog Number | R072602 |
| CAS Number | 72510-04-4 |
| Molecular Formula | C16H12NO3+ |
| Purity | ≥95% |
| IUPAC Name | 5,7-dioxa-12-azoniapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(18),2,4(8),9,11,15(19),16-heptaen-17-ol |
| InChI | InChI=1S/C16H11NO3/c18-11-3-9-1-2-17-7-10-4-14-15(20-8-19-14)6-12(10)13(5-11)16(9)17/h3-7H,1-2,8H2/p+1 |
| InChIKey | DFQOXFIPAAMFAU-UHFFFAOYSA-O |
| SMILES | C1C[N+]2=CC3=CC4=C(C=C3C5=CC(=CC1=C52)O)OCO4 |
