For research use only. Not for therapeutic Use.
Upidosin（Cat No.:I037865）is a potent and selective inhibitor of the protein kinase CK2, which plays a crucial role in regulating cellular processes like cell growth, proliferation, and survival. By inhibiting CK2, Upidosin disrupts its involvement in signaling pathways that are often dysregulated in various cancers and other diseases. This compound has shown promise in preclinical studies as a potential therapeutic agent for cancer, inflammation, and other CK2-related disorders. Researchers are exploring its use as a targeted therapy to treat malignancies with aberrant CK2 activity, aiming to improve treatment outcomes.
| CAS Number | 152735-23-4 |
| Synonyms | N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| Molecular Formula | C31H33N3O4 |
| Purity | ≥95% |
| IUPAC Name | N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| InChI | InChI=1S/C31H33N3O4/c1-22-28(35)24-12-8-13-25(30(24)38-29(22)23-10-4-3-5-11-23)31(36)32-16-9-17-33-18-20-34(21-19-33)26-14-6-7-15-27(26)37-2/h3-8,10-15H,9,16-21H2,1-2H3,(H,32,36) |
| InChIKey | DUCNHKDCVVSJLG-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C(C1=O)C=CC=C2C(=O)NCCCN3CCN(CC3)C4=CC=CC=C4OC)C5=CC=CC=C5 |
