For research use only. Not for therapeutic Use.
Uplandicine(Cat No.:M014867) is a natural alkaloid found in the plant Erythrina Suburban, commonly known as the coral tree. This compound is part of a larger group of erythrina alkaloids, noted for their diverse pharmacological properties. Uplandicine is studied for its potential medicinal benefits, which include anti-inflammatory and neuroprotective effects. Alkaloids like uplandicine are of interest in pharmaceutical research due to their complex structures and biological activities, which may offer therapeutic options for diseases such as neurodegenerative disorders.
CAS Number | 74202-10-1 |
Synonyms | UPLANDICINE |
Molecular Formula | C17H27NO7 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(7R,8R)-7-acetyloxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2R)-2,3-dihydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoate |
InChI | InChI=1S/C17H27NO7/c1-10(19)17(23,16(3,4)22)15(21)24-9-12-5-7-18-8-6-13(14(12)18)25-11(2)20/h5,10,13-14,19,22-23H,6-9H2,1-4H3/t10-,13+,14+,17-/m0/s1 |
InChIKey | IHRIHUJNKKMIDN-YYGKBEQOSA-N |
SMILES | CC(C(C(=O)OCC1=CCN2C1C(CC2)OC(=O)C)(C(C)(C)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |