For research use only. Not for therapeutic Use.
Uplarafenib（Cat No.:I042905）is a selective small molecule inhibitor targeting the BRAF kinase, specifically the BRAF V600E mutation, which is commonly associated with various cancers, including melanoma, colorectal cancer, and non-small cell lung cancer. By inhibiting this mutated kinase, uplarafenib blocks the aberrant signaling pathway that promotes uncontrolled cell growth and survival in tumor cells. It is currently being investigated in clinical trials for its potential to treat BRAF-mutant cancers, either alone or in combination with other therapies, offering a promising strategy for targeted cancer treatment with improved efficacy.
| CAS Number | 1425485-87-5 |
| Synonyms | N-[2,4,5-trifluoro-3-(3-morpholin-4-ylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide |
| Molecular Formula | C22H21F3N4O4S |
| Purity | ≥95% |
| IUPAC Name | N-[2,4,5-trifluoro-3-(3-morpholin-4-ylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide |
| InChI | InChI=1S/C22H21F3N4O4S/c1-2-9-34(31,32)28-17-11-14(23)20(24)19(21(17)25)22(30)13-3-4-15-16(10-13)27-18(12-26-15)29-5-7-33-8-6-29/h3-4,10-12,28H,2,5-9H2,1H3 |
| InChIKey | HAYBWDINAFTFCJ-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)NC1=CC(=C(C(=C1F)C(=O)C2=CC3=NC(=CN=C3C=C2)N4CCOCC4)F)F |
