For research use only. Not for therapeutic Use.
Uracil-13C4(Cat No.:I041398)is a stable isotope-labeled form of uracil, where the carbon atoms are replaced with the carbon-13 isotope, denoted as 13C. This modification makes it useful in metabolic studies and tracer experiments, allowing researchers to track the incorporation of uracil into various biochemical pathways. Uracil is a key component of RNA and plays a critical role in nucleotide metabolism. Uracil-13C4 is widely used in isotopic labeling techniques to study nucleotide metabolism, RNA synthesis, and the biosynthesis of pyrimidine nucleotides, providing valuable insights into cellular processes and disease mechanisms.
Synonyms | (2,4,5,6-13C4)1H-pyrimidine-2,4-dione |
Molecular Formula | 13C4H2N2O2 |
Purity | ≥95% |
IUPAC Name | (2,4,5,6-13C4)1H-pyrimidine-2,4-dione |
InChI | InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8)/i1+1,2+1,3+1,4+1 |
InChIKey | ISAKRJDGNUQOIC-JCDJMFQYSA-N |
SMILES | [13CH]1=[13CH]N[13C](=O)N[13C]1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |