For research use only. Not for therapeutic Use.
Uralenol is a natural PTP1B inhibitor (IC50=21. 5 μM) from Broussonetia papyrifera. PTP1B have been shown to play a major role in the dephosphorylation of the insulin receptor in many cellular and biochemical studies[1].
| Catalog Number | M118879 |
| CAS Number | 139163-15-8 |
| Synonyms | 2-[3,4-dihydroxy-5-(3-methylbut-2-enyl)phenyl]-3,5,7-trihydroxychromen-4-one |
| Molecular Formula | C20H18O7 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H18O7/c1-9(2)3-4-10-5-11(6-14(23)17(10)24)20-19(26)18(25)16-13(22)7-12(21)8-15(16)27-20/h3,5-8,21-24,26H,4H2,1-2H3 |
| InChIKey | WOMWVGHYSNATOB-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O)C |
| Reference | [1]. Chen RM, et al. Natural PTP1B inhibitors from Broussonetia papyrifera. Bioorg Med Chem Lett. 2002;12(23):3387-3390. |
