For research use only. Not for therapeutic Use.
URAT1&XO inhibitor 1(CAT: I040907) is a dual inhibitor targeting both xanthine oxidase (XO) and urate transporter 1 (URAT1), which play critical roles in the regulation of uric acid levels. XO is responsible for the production of uric acid, while URAT1 is involved in the reabsorption of uric acid in the kidneys. By inhibiting both pathways, URAT1&XO inhibitor 1 can reduce the overall serum urate levels and prevent the formation of urate crystals, which are implicated in conditions like gout and hyperuricemia. This compound is highly relevant for research in the treatment of inflammatory diseases related to high uric acid levels, such as gout and certain cardiovascular diseases.
CAS Number | 2669726-78-5 |
Synonyms | 5-[[5-cyano-1-(pyridin-2-ylmethyl)indole-3-carbonyl]amino]-1,3-thiazole-4-carboxylic acid |
Molecular Formula | C20H13N5O3S |
Purity | ≥95% |
IUPAC Name | 5-[[5-cyano-1-(pyridin-2-ylmethyl)indole-3-carbonyl]amino]-1,3-thiazole-4-carboxylic acid |
InChI | InChI=1S/C20H13N5O3S/c21-8-12-4-5-16-14(7-12)15(10-25(16)9-13-3-1-2-6-22-13)18(26)24-19-17(20(27)28)23-11-29-19/h1-7,10-11H,9H2,(H,24,26)(H,27,28) |
InChIKey | YUGFHWXZQLEUKC-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)CN2C=C(C3=C2C=CC(=C3)C#N)C(=O)NC4=C(N=CS4)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |