For research use only. Not for therapeutic Use.
Urethane-d5 (Cat.No:R047690) is a deuterated form of urethane, a chemical compound also known as ethyl carbamate. Deuterated compounds contain hydrogen isotopes, replacing some of the hydrogen atoms with deuterium. Urethane-d5 is often used as an internal standard in analytical chemistry and research studies to facilitate accurate quantification and analysis.
CAS Number | 73962-07-9 |
Synonyms | Carbamic Acid (Ethyl-d5)Ester; Ethyl-d5 Aminoformate; Ethyl-d5 Carbamate; (Ethyl-d5)urethane; Leucethane-d5; NSC 746-d5; O-(Ethyl-d5)urethane; Pracarbamine-d5; Urethan-d5; |
Molecular Formula | C3H7NO2 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 1,1,2,2,2-pentadeuterioethyl carbamate |
InChI | InChI=1S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5)/i1D3,2D2 |
InChIKey | JOYRKODLDBILNP-ZBJDZAJPSA-N |
SMILES | CCOC(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |