For research use only. Not for therapeutic Use.
Urethane-d5 (Cat.No:R047690) is a deuterated form of urethane, a chemical compound also known as ethyl carbamate. Deuterated compounds contain hydrogen isotopes, replacing some of the hydrogen atoms with deuterium. Urethane-d5 is often used as an internal standard in analytical chemistry and research studies to facilitate accurate quantification and analysis.
| Catalog Number | R047690 |
| CAS Number | 73962-07-9 |
| Synonyms | Carbamic Acid (Ethyl-d5)Ester; Ethyl-d5 Aminoformate; Ethyl-d5 Carbamate; (Ethyl-d5)urethane; Leucethane-d5; NSC 746-d5; O-(Ethyl-d5)urethane; Pracarbamine-d5; Urethan-d5; |
| Molecular Formula | C3H7NO2 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | 1,1,2,2,2-pentadeuterioethyl carbamate |
| InChI | InChI=1S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5)/i1D3,2D2 |
| InChIKey | JOYRKODLDBILNP-ZBJDZAJPSA-N |
| SMILES | CCOC(=O)N |
