For research use only. Not for therapeutic Use.
Urethane(Cat No.:I003869), also known as ethyl carbamate, is an organic compound with various applications in medicine and industry. In a medical context, urethane has been historically used as an anesthetic and in certain laboratory settings as a chemical reagent, although its use in humans is now limited due to potential toxicity. Industrially, urethane serves as a precursor in producing polymers, including polyurethanes used in foams, coatings, and adhesives. Additionally, it can form naturally in fermented foods and beverages, prompting regulatory attention due to its carcinogenic potential at higher exposures.
Catalog Number | I003869 |
CAS Number | 51-79-6 |
Molecular Formula | C3H7NO2 |
Purity | ≥95% |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IUPAC Name | ethyl carbamate |
InChI | InChI=1S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5) |
InChIKey | JOYRKODLDBILNP-UHFFFAOYSA-N |
SMILES | CCOC(=O)N |
Reference | <p style=/line-height:25px/> |