For research use only. Not for therapeutic Use.
Uridine-13C（Cat No.:R041429）is a stable isotopic form of uridine, where the carbon atoms in the molecule are replaced with the isotope 13C, enabling precise tracking and analysis in metabolic studies. Uridine is a nucleoside composed of uracil and ribose, essential for RNA synthesis and cellular metabolism. The incorporation of 13C into uridine allows researchers to monitor its metabolism and utilization in cellular processes through techniques like mass spectrometry and NMR spectroscopy. Uridine-13C is valuable in metabolic flux analysis, RNA turnover studies, and investigating nucleotide biosynthesis pathways in various biological systems.
| CAS Number | 201996-62-5 |
| Synonyms | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)(213C)oxolan-2-yl]pyrimidine-2,4-dione |
| Molecular Formula | C813CH12N2O6 |
| Purity | ≥95% |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)(213C)oxolan-2-yl]pyrimidine-2,4-dione |
| InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1/i8+1 |
| InChIKey | DRTQHJPVMGBUCF-URLSOCJKSA-N |
| SMILES | C1=CN(C(=O)NC1=O)[13C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
