Uridine-13C,15N2(Cat No.:S000520) is an isotopically labeled form of uridine, where the carbon atom is replaced with carbon-13 (13C) and the two nitrogen atoms are replaced with nitrogen-15 (15N). This labeling is used to enhance the detection and analysis of uridine in nucleic acid metabolism and cellular studies, utilizing techniques like nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. By tracing these isotopes, researchers can gain detailed insights into RNA synthesis, degradation, and its role in various biochemical pathways. This is essential for advancing our understanding of genetic regulation and function in health and disease.
Catalog Number | S000520 |
CAS Number | 369656-75-7 |
Molecular Formula | C813CH1215N2O6 |
Purity | % |
IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl](213C,1,3-15N2)pyrimidine-2,4-dione |
InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1/i9+1,10+1,11+1 |
InChIKey | DRTQHJPVMGBUCF-CNANCEAGSA-N |
SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |