For research use only. Not for therapeutic Use.
Uridine-13C5(Cat No.:S000528) is an isotopically labeled version of uridine, where five of its carbon atoms are replaced with carbon-13 (13C) isotopes. Uridine is a nucleoside that forms part of RNA and plays a role in various biological processes, including the synthesis of the brain’s phospholipids and neurotransmitters, potentially influencing cognitive function. The 13C labeling in uridine-13C5 allows for enhanced tracking and analysis of metabolic pathways involving RNA synthesis and degradation. This capability is especially valuable in research focused on cellular metabolism, neurological health, and the development of treatments for cognitive disorders.
CAS Number | 159496-16-9 |
Molecular Formula | C413C5H12N2O6 |
Purity | ≥95% |
IUPAC Name | 5-deuterio-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]pyrimidine-2,4-dione |
InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1/i1D,3+1,4+1,6+1,7+1,8+1 |
InChIKey | DRTQHJPVMGBUCF-WDBXUEINSA-N |
SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |