For research use only. Not for therapeutic Use.
Uridine-15N2 is a high-purity isotopically labeled compound essential for advanced pharmaceutical and biochemical research. This version of Uridine incorporates two nitrogen-15 atoms, making it a critical tool for studies on RNA synthesis, nucleic acid metabolism, and cellular processes. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of metabolic and pharmacokinetic studies. With improved stability and consistency, Uridine-15N2 integrates seamlessly into various experimental protocols, offering a robust and cost-effective solution for high-precision scientific investigations. Ideal for research and development, it supports the advancement of safer and more effective therapeutic agents.
| Catalog Number | S001047 |
| CAS Number | 92487-68-8 |
| Molecular Formula | C9H1215N2O6 |
| Purity | ≥95% |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl](1,3-15N2)pyrimidine-2,4-dione |
| InChI | InChI=1S/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6-,7-,8-/m1/s1/i10+1,11+1 |
| InChIKey | DRTQHJPVMGBUCF-DMNIUWJGSA-N |
| SMILES | C1=C[15N](C(=O)[15NH]C1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
