For research use only. Not for therapeutic Use.
URMC-099（Cat No.:I000904）is a potent, brain-penetrant inhibitor of mixed-lineage kinases (MLKs), which are involved in the regulation of neuroinflammation and neuronal survival. By inhibiting MLKs, URMC-099 effectively blocks downstream activation of JNK and p38 MAPK, reducing inflammation and protecting against neurotoxic effects. It has been studied for its potential to treat neurodegenerative diseases such as Alzheimer’s and Parkinson’s, as well as HIV-associated neurocognitive disorders. URMC-099 is a valuable tool in researching the role of MLKs in neuroinflammation, providing insights into therapeutic strategies for neuroprotective and anti-inflammatory treatments.
| Catalog Number | I000904 |
| CAS Number | 1229582-33-5 |
| Synonyms | 3-(1H-indol-5-yl)-5-[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine; URMC099 |
| Molecular Formula | C₂₇H₂₇N₅ |
| Purity | 97% |
| Target | Autophagy |
| Solubility | DMSO: ≥ 33 mg/mL |
| Appearance | Solid powder |
| Storage | -20°C |
| IC50 | 14 nM |
| IUPAC Name | 3-(1H-indol-5-yl)-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine |
| InChI | InChI=1S/C27H27N5/c1-31-10-12-32(13-11-31)18-19-2-4-20(5-3-19)23-15-24-25(17-30-27(24)29-16-23)21-6-7-26-22(14-21)8-9-28-26/h2-9,14-17,28H,10-13,18H2,1H3,(H,29,30) |
| InChIKey | QKKIWEILHCXECO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C3=CC4=C(NC=C4C5=CC6=C(C=C5)NC=C6)N=C3 |
| Reference | <br /> |
