For research use only. Not for therapeutic Use.
Urolithin C is a metabolite produced in the gut following the consumption of polyphenolic compounds, particularly ellagitannins, found in foods like pomegranates, berries, and nuts. It is a derivative of urolithins, which are known for their antioxidant and anti-inflammatory properties. Urolithin C has been studied for its potential health benefits, including promoting cellular health, improving mitochondrial function, and reducing oxidative stress. Research suggests it may play a role in protecting against age-related diseases, though further studies are needed.
| Catalog Number | R014665 |
| CAS Number | 165393-06-6 |
| Synonyms | 3,8,9-Trihydroxy-6H-benzo[c]chromen-6-one; 3,8,9-Trihydroxyurolithin; 3,8,9-Trihydroxy-6H-Dibenzo[b,d]pyran-6-one |
| Molecular Formula | C13H8O5 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | Desiccate at RT |
| IUPAC Name | 3,8,9-trihydroxybenzo[c]chromen-6-one |
| InChI | InChI=1S/C13H8O5/c14-6-1-2-7-8-4-10(15)11(16)5-9(8)13(17)18-12(7)3-6/h1-5,14-16H |
| InChIKey | HHXMEXZVPJFAIJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC(=O)C3=CC(=C(C=C23)O)O |
